About N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide
N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide (PubChem CID 61253512) has the molecular formula C9H18N6O2S
and a molecular weight of 274.35 g/mol. Its IUPAC name is N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide.
Molecular Properties
| Compound Name | N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide |
| PubChem CID | 61253512 |
| Molecular Formula | C9H18N6O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide |
| SMILES | CC(NS(=O)(=O)N1CCNCC1)c1nncn1C |
| InChI | InChI=1S/C9H18N6O2S/c1-8(9-12-11-7-14(9)2)13-18(16,17)15-5-3-10-4-6-15/h7-8,10,13H,3-6H2,1-2H3 |
| InChIKey | ITFBCXVRKUZVEA-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide?
The IUPAC name of N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide (CID 61253512) is N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide.
What is the SMILES notation for N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide?
The canonical SMILES for N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide is CC(NS(=O)(=O)N1CCNCC1)c1nncn1C.
What is the InChIKey of N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide?
The InChIKey is ITFBCXVRKUZVEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N6O2S/c1-8(9-12-11-7-14(9)2)13-18(16,17)15-5-3-10-4-6-15/h7-8,10,13H,3-6H2,1-2H3.
What are the key properties of N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide?
N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide has a molecular weight of 274.35 g/mol, XLogP of -1.38, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperazine-1-sulfonamide is sourced from PubChem (CID 61253512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).