C15H22N2O — CID 61255838
[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-pyridinyl]methanol (PubChem CID 61255838) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is [4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-pyridinyl]methanol.
| Compound Name | [4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 61255838 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | [4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-2-pyridinyl]methanol |
| SMILES | OCc1cc(N2CCC3CCCCC3C2)ccn1 |
| InChI | InChI=1S/C15H22N2O/c18-11-14-9-15(5-7-16-14)17-8-6-12-3-1-2-4-13(12)10-17/h5,7,9,12-13,18H,1-4,6,8,10-11H2 |
| InChIKey | MSYVUWDYURJCNJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |