About [4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol
[4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol (PubChem CID 61256108) has the molecular formula C12H9Cl2NO2
and a molecular weight of 270.12 g/mol. Its IUPAC name is [4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol.
Molecular Properties
| Compound Name | [4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol |
| PubChem CID | 61256108 |
| Molecular Formula | C12H9Cl2NO2 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | [4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol |
| SMILES | OCc1cc(Oc2cc(Cl)cc(Cl)c2)ccn1 |
| InChI | InChI=1S/C12H9Cl2NO2/c13-8-3-9(14)5-12(4-8)17-11-1-2-15-10(6-11)7-16/h1-6,16H,7H2 |
| InChIKey | LXDNPOWQESYKRI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol?
The IUPAC name of [4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol (CID 61256108) is [4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol.
What is the SMILES notation for [4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol?
The canonical SMILES for [4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol is OCc1cc(Oc2cc(Cl)cc(Cl)c2)ccn1.
What is the InChIKey of [4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol?
The InChIKey is LXDNPOWQESYKRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl2NO2/c13-8-3-9(14)5-12(4-8)17-11-1-2-15-10(6-11)7-16/h1-6,16H,7H2.
What are the key properties of [4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol?
[4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol has a molecular weight of 270.12 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,5-dichlorophenoxy)-2-pyridinyl]methanol is sourced from PubChem (CID 61256108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).