C11H17NO3 — CID 61257365
[2-(2-methoxyethoxy)-4,6-dimethyl-3-pyridinyl]methanol (PubChem CID 61257365) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is [2-(2-methoxyethoxy)-4,6-dimethyl-3-pyridinyl]methanol.
| Compound Name | [2-(2-methoxyethoxy)-4,6-dimethyl-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 61257365 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | [2-(2-methoxyethoxy)-4,6-dimethyl-3-pyridinyl]methanol |
| SMILES | COCCOc1nc(C)cc(C)c1CO |
| InChI | InChI=1S/C11H17NO3/c1-8-6-9(2)12-11(10(8)7-13)15-5-4-14-3/h6,13H,4-5,7H2,1-3H3 |
| InChIKey | GFUFGDPIYVVSAB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|