About 4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine
4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine (PubChem CID 61257804) has the molecular formula C11H16ClN3O
and a molecular weight of 241.72 g/mol. Its IUPAC name is 4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine |
| PubChem CID | 61257804 |
| Molecular Formula | C11H16ClN3O |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine |
| SMILES | CC1CN(c2ccc(CCl)nn2)CC(C)O1 |
| InChI | InChI=1S/C11H16ClN3O/c1-8-6-15(7-9(2)16-8)11-4-3-10(5-12)13-14-11/h3-4,8-9H,5-7H2,1-2H3 |
| InChIKey | ARADUHZZUYWQAU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine?
The IUPAC name of 4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine (CID 61257804) is 4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine.
What is the SMILES notation for 4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine?
The canonical SMILES for 4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine is CC1CN(c2ccc(CCl)nn2)CC(C)O1.
What is the InChIKey of 4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine?
The InChIKey is ARADUHZZUYWQAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClN3O/c1-8-6-15(7-9(2)16-8)11-4-3-10(5-12)13-14-11/h3-4,8-9H,5-7H2,1-2H3.
What are the key properties of 4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine?
4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine has a molecular weight of 241.72 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(chloromethyl)pyridazin-3-yl]-2,6-dimethylmorpholine is sourced from PubChem (CID 61257804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).