C16H12N4O — CID 61258694
N-(1H-indazol-6-yl)-1H-indole-4-carboxamide (PubChem CID 61258694) has the molecular formula C16H12N4O and a molecular weight of 276.30 g/mol. Its IUPAC name is N-(1H-indazol-6-yl)-1H-indole-4-carboxamide.
| Compound Name | N-(1H-indazol-6-yl)-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 61258694 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-(1H-indazol-6-yl)-1H-indole-4-carboxamide |
| SMILES | O=C(Nc1ccc2cn[nH]c2c1)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C16H12N4O/c21-16(13-2-1-3-14-12(13)6-7-17-14)19-11-5-4-10-9-18-20-15(10)8-11/h1-9,17H,(H,18,20)(H,19,21) |
| InChIKey | FYSZTMSERKCNBQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |