C15H21N3O — CID 61258712
N-(4-aminobutyl)-2,3-dimethyl-1H-indole-5-carboxamide (PubChem CID 61258712) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is N-(4-aminobutyl)-2,3-dimethyl-1H-indole-5-carboxamide.
| Compound Name | N-(4-aminobutyl)-2,3-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 61258712 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-(4-aminobutyl)-2,3-dimethyl-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)NCCCCN)cc2c1C |
| InChI | InChI=1S/C15H21N3O/c1-10-11(2)18-14-6-5-12(9-13(10)14)15(19)17-8-4-3-7-16/h5-6,9,18H,3-4,7-8,16H2,1-2H3,(H,17,19) |
| InChIKey | YOWIXTXYTPWOHH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|