C14H17NO2 — CID 61262926
2-(3-methoxyphenyl)-4,4-dimethyl-3-oxopentanenitrile (PubChem CID 61262926) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-4,4-dimethyl-3-oxopentanenitrile.
| Compound Name | 2-(3-methoxyphenyl)-4,4-dimethyl-3-oxopentanenitrile |
|---|---|
| PubChem CID | 61262926 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-(3-methoxyphenyl)-4,4-dimethyl-3-oxopentanenitrile |
| SMILES | COc1cccc(C(C#N)C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H17NO2/c1-14(2,3)13(16)12(9-15)10-6-5-7-11(8-10)17-4/h5-8,12H,1-4H3 |
| InChIKey | WBHDAXUFAVBINU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |