C13H16N4O3 — CID 61263067
2-[4-[(2-hydroxy-4-methoxyphenyl)methylamino]pyrazol-1-yl]acetamide (PubChem CID 61263067) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-[4-[(2-hydroxy-4-methoxyphenyl)methylamino]pyrazol-1-yl]acetamide.
| Compound Name | 2-[4-[(2-hydroxy-4-methoxyphenyl)methylamino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 61263067 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-[4-[(2-hydroxy-4-methoxyphenyl)methylamino]pyrazol-1-yl]acetamide |
| SMILES | COc1ccc(CNc2cnn(CC(N)=O)c2)c(O)c1 |
| InChI | InChI=1S/C13H16N4O3/c1-20-11-3-2-9(12(18)4-11)5-15-10-6-16-17(7-10)8-13(14)19/h2-4,6-7,15,18H,5,8H2,1H3,(H2,14,19) |
| InChIKey | QOBBGSJUBHAZKQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|