C13H16F3NO — CID 612643
1-[2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 612643) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is 1-[2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 612643 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-[2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | C=CCC1C=CCC(CC=C)N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO/c1-3-6-10-8-5-9-11(7-4-2)17(10)12(18)13(14,15)16/h3-5,8,10-11H,1-2,6-7,9H2 |
| InChIKey | VFAMHPYELWVUBV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|