C11H10F2N2O2 — CID 61265928
3-(2,4-difluorophenyl)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 61265928) has the molecular formula C11H10F2N2O2 and a molecular weight of 240.21 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-(2,4-difluorophenyl)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 61265928 |
| Molecular Formula | C11H10F2N2O2 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 3-(2,4-difluorophenyl)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(c2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C11H10F2N2O2/c1-11(2)9(16)15(10(17)14-11)8-4-3-6(12)5-7(8)13/h3-5H,1-2H3,(H,14,17) |
| InChIKey | JTCIJMKEWMUJOU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|