C16H23NO4 — CID 61267567
2-(2-formyl-5-methoxyphenoxy)-N-pentylpropanamide (PubChem CID 61267567) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-(2-formyl-5-methoxyphenoxy)-N-pentylpropanamide.
| Compound Name | 2-(2-formyl-5-methoxyphenoxy)-N-pentylpropanamide |
|---|---|
| PubChem CID | 61267567 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-(2-formyl-5-methoxyphenoxy)-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)C(C)Oc1cc(OC)ccc1C=O |
| InChI | InChI=1S/C16H23NO4/c1-4-5-6-9-17-16(19)12(2)21-15-10-14(20-3)8-7-13(15)11-18/h7-8,10-12H,4-6,9H2,1-3H3,(H,17,19) |
| InChIKey | HZXYLALHYXCKSS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|