C16H19NO2 — CID 61267847
2-[(2,5-dimethylanilino)methyl]-5-methoxyphenol (PubChem CID 61267847) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-[(2,5-dimethylanilino)methyl]-5-methoxyphenol.
| Compound Name | 2-[(2,5-dimethylanilino)methyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 61267847 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-[(2,5-dimethylanilino)methyl]-5-methoxyphenol |
| SMILES | COc1ccc(CNc2cc(C)ccc2C)c(O)c1 |
| InChI | InChI=1S/C16H19NO2/c1-11-4-5-12(2)15(8-11)17-10-13-6-7-14(19-3)9-16(13)18/h4-9,17-18H,10H2,1-3H3 |
| InChIKey | MABHBWKTZZKURE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|