C12H16ClNO2 — CID 61268017
2-[2-(2-chloroprop-2-enoxy)-4-methoxyphenyl]ethanamine (PubChem CID 61268017) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 2-[2-(2-chloroprop-2-enoxy)-4-methoxyphenyl]ethanamine.
| Compound Name | 2-[2-(2-chloroprop-2-enoxy)-4-methoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 61268017 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-[2-(2-chloroprop-2-enoxy)-4-methoxyphenyl]ethanamine |
| SMILES | C=C(Cl)COc1cc(OC)ccc1CCN |
| InChI | InChI=1S/C12H16ClNO2/c1-9(13)8-16-12-7-11(15-2)4-3-10(12)5-6-14/h3-4,7H,1,5-6,8,14H2,2H3 |
| InChIKey | KKNSEZOLCAKKPI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |