About 4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one
4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one (PubChem CID 61270415) has the molecular formula C14H25N3O3S
and a molecular weight of 315.44 g/mol. Its IUPAC name is 4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one.
Molecular Properties
| Compound Name | 4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one |
| PubChem CID | 61270415 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one |
| SMILES | CCCc1c(N)c(=O)n(C2(C)CCS(=O)(=O)C2)n1CCC |
| InChI | InChI=1S/C14H25N3O3S/c1-4-6-11-12(15)13(18)17(16(11)8-5-2)14(3)7-9-21(19,20)10-14/h4-10,15H2,1-3H3 |
| InChIKey | RMWANESEPHJNGA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one?
The IUPAC name of 4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one (CID 61270415) is 4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one.
What is the SMILES notation for 4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one?
The canonical SMILES for 4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one is CCCc1c(N)c(=O)n(C2(C)CCS(=O)(=O)C2)n1CCC.
What is the InChIKey of 4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one?
The InChIKey is RMWANESEPHJNGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O3S/c1-4-6-11-12(15)13(18)17(16(11)8-5-2)14(3)7-9-21(19,20)10-14/h4-10,15H2,1-3H3.
What are the key properties of 4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one?
4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one has a molecular weight of 315.44 g/mol, XLogP of 1.13, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(3-methyl-1,1-dioxothiolan-3-yl)-1,5-dipropylpyrazol-3-one is sourced from PubChem (CID 61270415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).