C14H14Cl2N2O2 — CID 61271481
1-butan-2-yl-3-(2,5-dichlorophenyl)pyrazole-4-carboxylic acid (PubChem CID 61271481) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is 1-butan-2-yl-3-(2,5-dichlorophenyl)pyrazole-4-carboxylic acid.
| Compound Name | 1-butan-2-yl-3-(2,5-dichlorophenyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 61271481 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 1-butan-2-yl-3-(2,5-dichlorophenyl)pyrazole-4-carboxylic acid |
| SMILES | CCC(C)n1cc(C(=O)O)c(-c2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c1-3-8(2)18-7-11(14(19)20)13(17-18)10-6-9(15)4-5-12(10)16/h4-8H,3H2,1-2H3,(H,19,20) |
| InChIKey | FRWSGSAANOIOIW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |