About (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone
(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone (PubChem CID 61272983) has the molecular formula C13H13BrO4
and a molecular weight of 313.15 g/mol. Its IUPAC name is (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone.
Molecular Properties
| Compound Name | (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone |
| PubChem CID | 61272983 |
| Molecular Formula | C13H13BrO4 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone |
| SMILES | O=C(c1cc2c(cc1Br)OCCO2)C1CCOC1 |
| InChI | InChI=1S/C13H13BrO4/c14-10-6-12-11(17-3-4-18-12)5-9(10)13(15)8-1-2-16-7-8/h5-6,8H,1-4,7H2 |
| InChIKey | CJPSAQTWNRCJPH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone?
The IUPAC name of (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone (CID 61272983) is (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone.
What is the SMILES notation for (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone?
The canonical SMILES for (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone is O=C(c1cc2c(cc1Br)OCCO2)C1CCOC1.
What is the InChIKey of (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone?
The InChIKey is CJPSAQTWNRCJPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrO4/c14-10-6-12-11(17-3-4-18-12)5-9(10)13(15)8-1-2-16-7-8/h5-6,8H,1-4,7H2.
What are the key properties of (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone?
(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone has a molecular weight of 313.15 g/mol, XLogP of 2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-(oxolan-3-yl)methanone is sourced from PubChem (CID 61272983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).