C24H22N2O3 — CID 6127402
(E)-2-cyano-N-(oxolan-2-ylmethyl)-3-(2-phenyl-2H-chromen-3-yl)prop-2-enamide (PubChem CID 6127402) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is (E)-2-cyano-N-(oxolan-2-ylmethyl)-3-(2-phenyl-2H-chromen-3-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(oxolan-2-ylmethyl)-3-(2-phenyl-2H-chromen-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6127402 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (E)-2-cyano-N-(oxolan-2-ylmethyl)-3-(2-phenyl-2H-chromen-3-yl)prop-2-enamide |
| SMILES | N#C/C(=C\C1=Cc2ccccc2OC1c1ccccc1)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C24H22N2O3/c25-15-20(24(27)26-16-21-10-6-12-28-21)14-19-13-18-9-4-5-11-22(18)29-23(19)17-7-2-1-3-8-17/h1-5,7-9,11,13-14,21,23H,6,10,12,16H2,(H,26,27)/b20-14+ |
| InChIKey | SURQUUQZBIJSDK-XSFVSMFZSA-N |
| XLogP | 3.95 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|