C14H14N2O3S — CID 61274764
N-(2,3-dihydro-1H-inden-1-yl)-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 61274764) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-1-yl)-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-(2,3-dihydro-1H-inden-1-yl)-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61274764 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-1-yl)-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | O=c1ccc(S(=O)(=O)NC2CCc3ccccc32)c[nH]1 |
| InChI | InChI=1S/C14H14N2O3S/c17-14-8-6-11(9-15-14)20(18,19)16-13-7-5-10-3-1-2-4-12(10)13/h1-4,6,8-9,13,16H,5,7H2,(H,15,17) |
| InChIKey | ABZOZIQMBFBQJK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |