C14H13N5O — CID 61274777
4-amino-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzamide (PubChem CID 61274777) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-amino-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzamide.
| Compound Name | 4-amino-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 61274777 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-amino-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzamide |
| SMILES | Nc1ccc(C(=O)NCc2nnc3ccccn23)cc1 |
| InChI | InChI=1S/C14H13N5O/c15-11-6-4-10(5-7-11)14(20)16-9-13-18-17-12-3-1-2-8-19(12)13/h1-8H,9,15H2,(H,16,20) |
| InChIKey | SCOXBEFXXUKLBB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|