C15H10N4OSe — CID 61274793
N-(2,1,3-benzoselenadiazol-4-yl)-1H-indole-4-carboxamide (PubChem CID 61274793) has the molecular formula C15H10N4OSe and a molecular weight of 341.23 g/mol. Its IUPAC name is N-(2,1,3-benzoselenadiazol-4-yl)-1H-indole-4-carboxamide.
| Compound Name | N-(2,1,3-benzoselenadiazol-4-yl)-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 61274793 |
| Molecular Formula | C15H10N4OSe |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | N-(2,1,3-benzoselenadiazol-4-yl)-1H-indole-4-carboxamide |
| SMILES | O=C(Nc1cccc2n[se]nc12)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C15H10N4OSe/c20-15(10-3-1-4-11-9(10)7-8-16-11)17-12-5-2-6-13-14(12)19-21-18-13/h1-8,16H,(H,17,20) |
| InChIKey | JPJBAIGUKNTAIX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|