C10H20N2O3 — CID 61274918
2-amino-2-cyclopropyl-N-(2,2-dimethoxyethyl)propanamide (PubChem CID 61274918) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-amino-2-cyclopropyl-N-(2,2-dimethoxyethyl)propanamide.
| Compound Name | 2-amino-2-cyclopropyl-N-(2,2-dimethoxyethyl)propanamide |
|---|---|
| PubChem CID | 61274918 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-amino-2-cyclopropyl-N-(2,2-dimethoxyethyl)propanamide |
| SMILES | COC(CNC(=O)C(C)(N)C1CC1)OC |
| InChI | InChI=1S/C10H20N2O3/c1-10(11,7-4-5-7)9(13)12-6-8(14-2)15-3/h7-8H,4-6,11H2,1-3H3,(H,12,13) |
| InChIKey | WUYGQKGSUFAWEI-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|