About N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide
N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 61275102) has the molecular formula C6H13N3OS
and a molecular weight of 175.26 g/mol. Its IUPAC name is N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide |
| PubChem CID | 61275102 |
| Molecular Formula | C6H13N3OS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | NCCNC(=O)C1CSCN1 |
| InChI | InChI=1S/C6H13N3OS/c7-1-2-8-6(10)5-3-11-4-9-5/h5,9H,1-4,7H2,(H,8,10) |
| InChIKey | LVNQIWLXMGNICD-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide?
The IUPAC name of N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide (CID 61275102) is N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide.
What is the SMILES notation for N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide?
The canonical SMILES for N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide is NCCNC(=O)C1CSCN1.
What is the InChIKey of N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide?
The InChIKey is LVNQIWLXMGNICD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3OS/c7-1-2-8-6(10)5-3-11-4-9-5/h5,9H,1-4,7H2,(H,8,10).
What are the key properties of N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide?
N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide has a molecular weight of 175.26 g/mol, XLogP of -1.28, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-1,3-thiazolidine-4-carboxamide is sourced from PubChem (CID 61275102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).