About 6-amino-N-(2,2-dimethoxyethyl)hexanamide
6-amino-N-(2,2-dimethoxyethyl)hexanamide (PubChem CID 61275661) has the molecular formula C10H22N2O3
and a molecular weight of 218.30 g/mol. Its IUPAC name is 6-amino-N-(2,2-dimethoxyethyl)hexanamide.
Molecular Properties
| Compound Name | 6-amino-N-(2,2-dimethoxyethyl)hexanamide |
| PubChem CID | 61275661 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 6-amino-N-(2,2-dimethoxyethyl)hexanamide |
| SMILES | COC(CNC(=O)CCCCCN)OC |
| InChI | InChI=1S/C10H22N2O3/c1-14-10(15-2)8-12-9(13)6-4-3-5-7-11/h10H,3-8,11H2,1-2H3,(H,12,13) |
| InChIKey | LWIYLNSRQWYQKE-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-N-(2,2-dimethoxyethyl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-(2,2-dimethoxyethyl)hexanamide?
The IUPAC name of 6-amino-N-(2,2-dimethoxyethyl)hexanamide (CID 61275661) is 6-amino-N-(2,2-dimethoxyethyl)hexanamide.
What is the SMILES notation for 6-amino-N-(2,2-dimethoxyethyl)hexanamide?
The canonical SMILES for 6-amino-N-(2,2-dimethoxyethyl)hexanamide is COC(CNC(=O)CCCCCN)OC.
What is the InChIKey of 6-amino-N-(2,2-dimethoxyethyl)hexanamide?
The InChIKey is LWIYLNSRQWYQKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O3/c1-14-10(15-2)8-12-9(13)6-4-3-5-7-11/h10H,3-8,11H2,1-2H3,(H,12,13).
What are the key properties of 6-amino-N-(2,2-dimethoxyethyl)hexanamide?
6-amino-N-(2,2-dimethoxyethyl)hexanamide has a molecular weight of 218.30 g/mol, XLogP of 0.24, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-(2,2-dimethoxyethyl)hexanamide is sourced from PubChem (CID 61275661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).