C10H8F2N4O4S — CID 61275948
N-(2,4-difluoro-5-nitrophenyl)-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 61275948) has the molecular formula C10H8F2N4O4S and a molecular weight of 318.26 g/mol. Its IUPAC name is N-(2,4-difluoro-5-nitrophenyl)-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(2,4-difluoro-5-nitrophenyl)-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61275948 |
| Molecular Formula | C10H8F2N4O4S |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | N-(2,4-difluoro-5-nitrophenyl)-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)Nc1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C10H8F2N4O4S/c1-5-10(4-13-14-5)21(19,20)15-8-3-9(16(17)18)7(12)2-6(8)11/h2-4,15H,1H3,(H,13,14) |
| InChIKey | LMGZKOZSOFEXJJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|