C6H5F3N6 — CID 612763
[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]hydrazine (PubChem CID 612763) has the molecular formula C6H5F3N6 and a molecular weight of 218.14 g/mol. Its IUPAC name is [3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]hydrazine.
| Compound Name | [3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]hydrazine |
|---|---|
| PubChem CID | 612763 |
| Molecular Formula | C6H5F3N6 |
| Molecular Weight | 218.14 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | [3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]hydrazine |
| SMILES | NNc1ccc2nnc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C6H5F3N6/c7-6(8,9)5-13-12-4-2-1-3(11-10)14-15(4)5/h1-2H,10H2,(H,11,14) |
| InChIKey | UWPXGNHYTITSIH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.14 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|