C12H10O4 — CID 612770
3,4,6,7-tetrahydropyrano[3,2-g]chromene-2,8-dione (PubChem CID 612770) has the molecular formula C12H10O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is 3,4,6,7-tetrahydropyrano[3,2-g]chromene-2,8-dione.
| Compound Name | 3,4,6,7-tetrahydropyrano[3,2-g]chromene-2,8-dione |
|---|---|
| PubChem CID | 612770 |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 3,4,6,7-tetrahydropyrano[3,2-g]chromene-2,8-dione |
| SMILES | O=C1CCc2cc3c(cc2O1)OC(=O)CC3 |
| InChI | InChI=1S/C12H10O4/c13-11-3-1-7-5-8-2-4-12(14)16-10(8)6-9(7)15-11/h5-6H,1-4H2 |
| InChIKey | IKOZXYXIXSYITL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|