C7H14N2O4S — CID 61277309
N-(2-sulfamoylethyl)oxolane-3-carboxamide (PubChem CID 61277309) has the molecular formula C7H14N2O4S and a molecular weight of 222.27 g/mol. Its IUPAC name is N-(2-sulfamoylethyl)oxolane-3-carboxamide.
| Compound Name | N-(2-sulfamoylethyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 61277309 |
| Molecular Formula | C7H14N2O4S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | N-(2-sulfamoylethyl)oxolane-3-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)C1CCOC1 |
| InChI | InChI=1S/C7H14N2O4S/c8-14(11,12)4-2-9-7(10)6-1-3-13-5-6/h6H,1-5H2,(H,9,10)(H2,8,11,12) |
| InChIKey | YLHSMQMKXQOCDI-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |