About 2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate
2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate (PubChem CID 61278270) has the molecular formula C13H21N3O3
and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate.
Molecular Properties
| Compound Name | 2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate |
| PubChem CID | 61278270 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate |
| SMILES | CC(C)OCCOC(=O)c1cnc(C2(N)CCC2)[nH]1 |
| InChI | InChI=1S/C13H21N3O3/c1-9(2)18-6-7-19-11(17)10-8-15-12(16-10)13(14)4-3-5-13/h8-9H,3-7,14H2,1-2H3,(H,15,16) |
| InChIKey | UGMFEYVNBSFVSO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate?
The IUPAC name of 2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate (CID 61278270) is 2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate.
What is the SMILES notation for 2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate?
The canonical SMILES for 2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate is CC(C)OCCOC(=O)c1cnc(C2(N)CCC2)[nH]1.
What is the InChIKey of 2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate?
The InChIKey is UGMFEYVNBSFVSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O3/c1-9(2)18-6-7-19-11(17)10-8-15-12(16-10)13(14)4-3-5-13/h8-9H,3-7,14H2,1-2H3,(H,15,16).
What are the key properties of 2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate?
2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate has a molecular weight of 267.33 g/mol, XLogP of 1.33, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxyethyl 2-(1-aminocyclobutyl)-1H-imidazole-5-carboxylate is sourced from PubChem (CID 61278270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).