About N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline
N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline (PubChem CID 61278325) has the molecular formula C10H12N4
and a molecular weight of 188.23 g/mol. Its IUPAC name is N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline.
Molecular Properties
| Compound Name | N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline |
| PubChem CID | 61278325 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline |
| SMILES | Cc1nc(CNc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C10H12N4/c1-8-12-10(14-13-8)7-11-9-5-3-2-4-6-9/h2-6,11H,7H2,1H3,(H,12,13,14) |
| InChIKey | IPEODSWCMMQSDQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline?
The IUPAC name of N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline (CID 61278325) is N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline.
What is the SMILES notation for N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline?
The canonical SMILES for N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline is Cc1nc(CNc2ccccc2)n[nH]1.
What is the InChIKey of N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline?
The InChIKey is IPEODSWCMMQSDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4/c1-8-12-10(14-13-8)7-11-9-5-3-2-4-6-9/h2-6,11H,7H2,1H3,(H,12,13,14).
What are the key properties of N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline?
N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline has a molecular weight of 188.23 g/mol, XLogP of 1.73, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-methyl-1H-1,2,4-triazol-3-yl)methyl]aniline is sourced from PubChem (CID 61278325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).