About cyclopentyl 3-amino-4-methylbenzoate
cyclopentyl 3-amino-4-methylbenzoate (PubChem CID 61278814) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is cyclopentyl 3-amino-4-methylbenzoate.
Molecular Properties
| Compound Name | cyclopentyl 3-amino-4-methylbenzoate |
| PubChem CID | 61278814 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | cyclopentyl 3-amino-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC2CCCC2)cc1N |
| InChI | InChI=1S/C13H17NO2/c1-9-6-7-10(8-12(9)14)13(15)16-11-4-2-3-5-11/h6-8,11H,2-5,14H2,1H3 |
| InChIKey | QQEOGEOMVAOMQH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl 3-amino-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl 3-amino-4-methylbenzoate?
The IUPAC name of cyclopentyl 3-amino-4-methylbenzoate (CID 61278814) is cyclopentyl 3-amino-4-methylbenzoate.
What is the SMILES notation for cyclopentyl 3-amino-4-methylbenzoate?
The canonical SMILES for cyclopentyl 3-amino-4-methylbenzoate is Cc1ccc(C(=O)OC2CCCC2)cc1N.
What is the InChIKey of cyclopentyl 3-amino-4-methylbenzoate?
The InChIKey is QQEOGEOMVAOMQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-9-6-7-10(8-12(9)14)13(15)16-11-4-2-3-5-11/h6-8,11H,2-5,14H2,1H3.
What are the key properties of cyclopentyl 3-amino-4-methylbenzoate?
cyclopentyl 3-amino-4-methylbenzoate has a molecular weight of 219.28 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl 3-amino-4-methylbenzoate is sourced from PubChem (CID 61278814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).