About 2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol
2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol (PubChem CID 61279338) has the molecular formula C5H10N4O
and a molecular weight of 142.16 g/mol. Its IUPAC name is 2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol |
| PubChem CID | 61279338 |
| Molecular Formula | C5H10N4O |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol |
| SMILES | Cc1nc(C(N)CO)n[nH]1 |
| InChI | InChI=1S/C5H10N4O/c1-3-7-5(9-8-3)4(6)2-10/h4,10H,2,6H2,1H3,(H,7,8,9) |
| InChIKey | YEVKFHNOMPTMPB-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol?
The IUPAC name of 2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol (CID 61279338) is 2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol.
What is the SMILES notation for 2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol?
The canonical SMILES for 2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol is Cc1nc(C(N)CO)n[nH]1.
What is the InChIKey of 2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol?
The InChIKey is YEVKFHNOMPTMPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4O/c1-3-7-5(9-8-3)4(6)2-10/h4,10H,2,6H2,1H3,(H,7,8,9).
What are the key properties of 2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol?
2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol has a molecular weight of 142.16 g/mol, XLogP of -0.89, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol is sourced from PubChem (CID 61279338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).