C16H23NO2 — CID 61279831
cyclohexyl 4-amino-4-phenylbutanoate (PubChem CID 61279831) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is cyclohexyl 4-amino-4-phenylbutanoate.
| Compound Name | cyclohexyl 4-amino-4-phenylbutanoate |
|---|---|
| PubChem CID | 61279831 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | cyclohexyl 4-amino-4-phenylbutanoate |
| SMILES | NC(CCC(=O)OC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c17-15(13-7-3-1-4-8-13)11-12-16(18)19-14-9-5-2-6-10-14/h1,3-4,7-8,14-15H,2,5-6,9-12,17H2 |
| InChIKey | LMBYZYWDCLJYNO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |