C13H14Cl2N2S — CID 61280310
N-[[2-(3,5-dichlorophenyl)-1,3-thiazol-4-yl]methyl]propan-1-amine (PubChem CID 61280310) has the molecular formula C13H14Cl2N2S and a molecular weight of 301.24 g/mol. Its IUPAC name is N-[[2-(3,5-dichlorophenyl)-1,3-thiazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(3,5-dichlorophenyl)-1,3-thiazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 61280310 |
| Molecular Formula | C13H14Cl2N2S |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | N-[[2-(3,5-dichlorophenyl)-1,3-thiazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1csc(-c2cc(Cl)cc(Cl)c2)n1 |
| InChI | InChI=1S/C13H14Cl2N2S/c1-2-3-16-7-12-8-18-13(17-12)9-4-10(14)6-11(15)5-9/h4-6,8,16H,2-3,7H2,1H3 |
| InChIKey | WXTKKOTVFMTMFL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|