About N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]ethanamine
N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]ethanamine (PubChem CID 61281051) has the molecular formula C9H14N2S
and a molecular weight of 182.29 g/mol. Its IUPAC name is N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]ethanamine.
Analyze N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]ethanamine?
The IUPAC name of N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]ethanamine (CID 61281051) is N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]ethanamine.
What is the SMILES notation for N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]ethanamine?
The canonical SMILES for N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]ethanamine is CCNCc1csc(C2CC2)n1.
What is the InChIKey of N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]ethanamine?
The InChIKey is DTLCRRLHKNFOIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2S/c1-2-10-5-8-6-12-9(11-8)7-3-4-7/h6-7,10H,2-5H2,1H3.
What are the key properties of N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]ethanamine?
N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]ethanamine has a molecular weight of 182.29 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-cyclopropyl-1,3-thiazol-4-yl)methyl]ethanamine is sourced from PubChem (CID 61281051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).