About (2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine
(2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine (PubChem CID 61281141) has the molecular formula C8H8N4S
and a molecular weight of 192.25 g/mol. Its IUPAC name is (2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine.
Molecular Properties
| Compound Name | (2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine |
| PubChem CID | 61281141 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine |
| SMILES | NCc1cnc(-c2ncccn2)s1 |
| InChI | InChI=1S/C8H8N4S/c9-4-6-5-12-8(13-6)7-10-2-1-3-11-7/h1-3,5H,4,9H2 |
| InChIKey | RXWKLMDJDYVCSD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine?
The IUPAC name of (2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine (CID 61281141) is (2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine.
What is the SMILES notation for (2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine?
The canonical SMILES for (2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine is NCc1cnc(-c2ncccn2)s1.
What is the InChIKey of (2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine?
The InChIKey is RXWKLMDJDYVCSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4S/c9-4-6-5-12-8(13-6)7-10-2-1-3-11-7/h1-3,5H,4,9H2.
What are the key properties of (2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine?
(2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine has a molecular weight of 192.25 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pyrimidin-2-yl-1,3-thiazol-5-yl)methanamine is sourced from PubChem (CID 61281141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).