About [2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine
[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine (PubChem CID 61281947) has the molecular formula C11H9ClN2O2S
and a molecular weight of 268.72 g/mol. Its IUPAC name is [2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine |
| PubChem CID | 61281947 |
| Molecular Formula | C11H9ClN2O2S |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | [2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine |
| SMILES | NCc1cnc(-c2cc(Cl)c3c(c2)OCO3)s1 |
| InChI | InChI=1S/C11H9ClN2O2S/c12-8-1-6(2-9-10(8)16-5-15-9)11-14-4-7(3-13)17-11/h1-2,4H,3,5,13H2 |
| InChIKey | QIHVIABQBJPCAM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine?
The IUPAC name of [2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine (CID 61281947) is [2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine.
What is the SMILES notation for [2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine?
The canonical SMILES for [2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine is NCc1cnc(-c2cc(Cl)c3c(c2)OCO3)s1.
What is the InChIKey of [2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine?
The InChIKey is QIHVIABQBJPCAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2O2S/c12-8-1-6(2-9-10(8)16-5-15-9)11-14-4-7(3-13)17-11/h1-2,4H,3,5,13H2.
What are the key properties of [2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine?
[2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine has a molecular weight of 268.72 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(7-chloro-1,3-benzodioxol-5-yl)-1,3-thiazol-5-yl]methanamine is sourced from PubChem (CID 61281947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).