About 3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid
3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid (PubChem CID 612821) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid.
Molecular Properties
| Compound Name | 3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid |
| PubChem CID | 612821 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid |
| SMILES | Cc1cc(C)c(C(C)(C)CC(=O)O)c(O)c1C |
| InChI | InChI=1S/C14H20O3/c1-8-6-9(2)12(13(17)10(8)3)14(4,5)7-11(15)16/h6,17H,7H2,1-5H3,(H,15,16) |
| InChIKey | HCWNNDVHYQWAMD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid?
The IUPAC name of 3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid (CID 612821) is 3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid.
What is the SMILES notation for 3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid?
The canonical SMILES for 3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid is Cc1cc(C)c(C(C)(C)CC(=O)O)c(O)c1C.
What is the InChIKey of 3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid?
The InChIKey is HCWNNDVHYQWAMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-8-6-9(2)12(13(17)10(8)3)14(4,5)7-11(15)16/h6,17H,7H2,1-5H3,(H,15,16).
What are the key properties of 3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid?
3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid has a molecular weight of 236.31 g/mol, XLogP of 3.07, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxy-3,4,6-trimethylphenyl)-3-methylbutanoic acid is sourced from PubChem (CID 612821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).