About 1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one
1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one (PubChem CID 61282388) has the molecular formula C10H16N4OS
and a molecular weight of 240.33 g/mol. Its IUPAC name is 1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one |
| PubChem CID | 61282388 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one |
| SMILES | Cc1ncc(CNCCN2CCNC2=O)s1 |
| InChI | InChI=1S/C10H16N4OS/c1-8-13-7-9(16-8)6-11-2-4-14-5-3-12-10(14)15/h7,11H,2-6H2,1H3,(H,12,15) |
| InChIKey | SKKVXXDIDKTWNR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one?
The IUPAC name of 1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one (CID 61282388) is 1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one.
What is the SMILES notation for 1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one?
The canonical SMILES for 1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one is Cc1ncc(CNCCN2CCNC2=O)s1.
What is the InChIKey of 1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one?
The InChIKey is SKKVXXDIDKTWNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4OS/c1-8-13-7-9(16-8)6-11-2-4-14-5-3-12-10(14)15/h7,11H,2-6H2,1H3,(H,12,15).
What are the key properties of 1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one?
1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one has a molecular weight of 240.33 g/mol, XLogP of 0.57, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(2-methyl-1,3-thiazol-5-yl)methylamino]ethyl]imidazolidin-2-one is sourced from PubChem (CID 61282388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).