About N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine
N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 61282727) has the molecular formula C11H14N2OS
and a molecular weight of 222.31 g/mol. Its IUPAC name is N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
| PubChem CID | 61282727 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(-c2ccco2)s1 |
| InChI | InChI=1S/C11H14N2OS/c1-2-5-12-7-9-8-13-11(15-9)10-4-3-6-14-10/h3-4,6,8,12H,2,5,7H2,1H3 |
| InChIKey | JQOBXVNYDWMJPA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine?
The IUPAC name of N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine (CID 61282727) is N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine.
What is the SMILES notation for N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine?
The canonical SMILES for N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine is CCCNCc1cnc(-c2ccco2)s1.
What is the InChIKey of N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine?
The InChIKey is JQOBXVNYDWMJPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS/c1-2-5-12-7-9-8-13-11(15-9)10-4-3-6-14-10/h3-4,6,8,12H,2,5,7H2,1H3.
What are the key properties of N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine?
N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine has a molecular weight of 222.31 g/mol, XLogP of 2.90, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(furan-2-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine is sourced from PubChem (CID 61282727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).