C14H17BrN2S — CID 61283101
N-[[2-[(4-bromophenyl)methyl]-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 61283101) has the molecular formula C14H17BrN2S and a molecular weight of 325.27 g/mol. Its IUPAC name is N-[[2-[(4-bromophenyl)methyl]-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(4-bromophenyl)methyl]-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 61283101 |
| Molecular Formula | C14H17BrN2S |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | N-[[2-[(4-bromophenyl)methyl]-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(Cc2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C14H17BrN2S/c1-2-7-16-9-13-10-17-14(18-13)8-11-3-5-12(15)6-4-11/h3-6,10,16H,2,7-9H2,1H3 |
| InChIKey | WEDRKHRCJDMYJH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|