C10H8IN3O4S3 — CID 61283779
2-[[5-[(4-iodophenyl)sulfonylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid (PubChem CID 61283779) has the molecular formula C10H8IN3O4S3 and a molecular weight of 457.30 g/mol. Its IUPAC name is 2-[[5-[(4-iodophenyl)sulfonylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[(4-iodophenyl)sulfonylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 61283779 |
| Molecular Formula | C10H8IN3O4S3 |
| Molecular Weight | 457.30 g/mol |
| Exact Mass | 456.87 |
| IUPAC Name | 2-[[5-[(4-iodophenyl)sulfonylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nnc(NS(=O)(=O)c2ccc(I)cc2)s1 |
| InChI | InChI=1S/C10H8IN3O4S3/c11-6-1-3-7(4-2-6)21(17,18)14-9-12-13-10(20-9)19-5-8(15)16/h1-4H,5H2,(H,12,14)(H,15,16) |
| InChIKey | BHFAQVNPQOBDQB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|