C9H15N3O3 — CID 61284127
2-(2-methoxyethoxy)-N-(1H-pyrazol-5-ylmethyl)acetamide (PubChem CID 61284127) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(1H-pyrazol-5-ylmethyl)acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(1H-pyrazol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 61284127 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(1H-pyrazol-5-ylmethyl)acetamide |
| SMILES | COCCOCC(=O)NCc1ccn[nH]1 |
| InChI | InChI=1S/C9H15N3O3/c1-14-4-5-15-7-9(13)10-6-8-2-3-11-12-8/h2-3H,4-7H2,1H3,(H,10,13)(H,11,12) |
| InChIKey | CKQZBGHFQPFYFK-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|