About 1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine
1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine (PubChem CID 61284427) has the molecular formula C9H14N2OS
and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine.
Molecular Properties
| Compound Name | 1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine |
| PubChem CID | 61284427 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine |
| SMILES | c1csc(CNCC2CCOC2)n1 |
| InChI | InChI=1S/C9H14N2OS/c1-3-12-7-8(1)5-10-6-9-11-2-4-13-9/h2,4,8,10H,1,3,5-7H2 |
| InChIKey | QCBFNSRVKRGSEQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine?
The IUPAC name of 1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine (CID 61284427) is 1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine.
What is the SMILES notation for 1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine?
The canonical SMILES for 1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine is c1csc(CNCC2CCOC2)n1.
What is the InChIKey of 1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine?
The InChIKey is QCBFNSRVKRGSEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2OS/c1-3-12-7-8(1)5-10-6-9-11-2-4-13-9/h2,4,8,10H,1,3,5-7H2.
What are the key properties of 1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine?
1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine has a molecular weight of 198.29 g/mol, XLogP of 1.27, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-3-yl)-N-(1,3-thiazol-2-ylmethyl)methanamine is sourced from PubChem (CID 61284427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).