C9H14N4O3 — CID 61285548
2-[4-(4-aminobutanoylamino)pyrazol-1-yl]acetic acid (PubChem CID 61285548) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 2-[4-(4-aminobutanoylamino)pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-(4-aminobutanoylamino)pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 61285548 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-[4-(4-aminobutanoylamino)pyrazol-1-yl]acetic acid |
| SMILES | NCCCC(=O)Nc1cnn(CC(=O)O)c1 |
| InChI | InChI=1S/C9H14N4O3/c10-3-1-2-8(14)12-7-4-11-13(5-7)6-9(15)16/h4-5H,1-3,6,10H2,(H,12,14)(H,15,16) |
| InChIKey | UWJZJIRQWPQQEI-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |