About (1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate
(1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate (PubChem CID 61285740) has the molecular formula C16H29N3O2
and a molecular weight of 295.43 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate |
| PubChem CID | 61285740 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | (1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate |
| SMILES | CN1CCC(OC(=O)C2CCCN2C2CCNCC2)CC1 |
| InChI | InChI=1S/C16H29N3O2/c1-18-11-6-14(7-12-18)21-16(20)15-3-2-10-19(15)13-4-8-17-9-5-13/h13-15,17H,2-12H2,1H3 |
| InChIKey | WQYIGNXQYRVWOG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate?
The IUPAC name of (1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate (CID 61285740) is (1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate.
What is the SMILES notation for (1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate?
The canonical SMILES for (1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate is CN1CCC(OC(=O)C2CCCN2C2CCNCC2)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate?
The InChIKey is WQYIGNXQYRVWOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N3O2/c1-18-11-6-14(7-12-18)21-16(20)15-3-2-10-19(15)13-4-8-17-9-5-13/h13-15,17H,2-12H2,1H3.
What are the key properties of (1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate?
(1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate has a molecular weight of 295.43 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) 1-piperidin-4-ylpyrrolidine-2-carboxylate is sourced from PubChem (CID 61285740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).