About 5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid
5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid (PubChem CID 61285924) has the molecular formula C9H9N3O3S2
and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid |
| PubChem CID | 61285924 |
| Molecular Formula | C9H9N3O3S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid |
| SMILES | Cc1cc(CSc2nnc(N)s2)oc1C(=O)O |
| InChI | InChI=1S/C9H9N3O3S2/c1-4-2-5(15-6(4)7(13)14)3-16-9-12-11-8(10)17-9/h2H,3H2,1H3,(H2,10,11)(H,13,14) |
| InChIKey | UEEPWVXQVBXRLX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid?
The IUPAC name of 5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid (CID 61285924) is 5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid.
What is the SMILES notation for 5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid?
The canonical SMILES for 5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid is Cc1cc(CSc2nnc(N)s2)oc1C(=O)O.
What is the InChIKey of 5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid?
The InChIKey is UEEPWVXQVBXRLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3S2/c1-4-2-5(15-6(4)7(13)14)3-16-9-12-11-8(10)17-9/h2H,3H2,1H3,(H2,10,11)(H,13,14).
What are the key properties of 5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid?
5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid has a molecular weight of 271.32 g/mol, XLogP of 2.01, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-3-methylfuran-2-carboxylic acid is sourced from PubChem (CID 61285924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).