C11H17ClN2 — CID 61286728
3-chloro-N-methyl-N-(2-pyridin-4-ylethyl)propan-1-amine (PubChem CID 61286728) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is 3-chloro-N-methyl-N-(2-pyridin-4-ylethyl)propan-1-amine.
| Compound Name | 3-chloro-N-methyl-N-(2-pyridin-4-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 61286728 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-chloro-N-methyl-N-(2-pyridin-4-ylethyl)propan-1-amine |
| SMILES | CN(CCCCl)CCc1ccncc1 |
| InChI | InChI=1S/C11H17ClN2/c1-14(9-2-6-12)10-5-11-3-7-13-8-4-11/h3-4,7-8H,2,5-6,9-10H2,1H3 |
| InChIKey | VRTGVRMDJZPTGE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|