About oxan-4-yl 2-(4-aminophenyl)acetate
oxan-4-yl 2-(4-aminophenyl)acetate (PubChem CID 61286946) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is oxan-4-yl 2-(4-aminophenyl)acetate.
Molecular Properties
| Compound Name | oxan-4-yl 2-(4-aminophenyl)acetate |
| PubChem CID | 61286946 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | oxan-4-yl 2-(4-aminophenyl)acetate |
| SMILES | Nc1ccc(CC(=O)OC2CCOCC2)cc1 |
| InChI | InChI=1S/C13H17NO3/c14-11-3-1-10(2-4-11)9-13(15)17-12-5-7-16-8-6-12/h1-4,12H,5-9,14H2 |
| InChIKey | GGZYBYILKSGZLQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze oxan-4-yl 2-(4-aminophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-4-yl 2-(4-aminophenyl)acetate?
The IUPAC name of oxan-4-yl 2-(4-aminophenyl)acetate (CID 61286946) is oxan-4-yl 2-(4-aminophenyl)acetate.
What is the SMILES notation for oxan-4-yl 2-(4-aminophenyl)acetate?
The canonical SMILES for oxan-4-yl 2-(4-aminophenyl)acetate is Nc1ccc(CC(=O)OC2CCOCC2)cc1.
What is the InChIKey of oxan-4-yl 2-(4-aminophenyl)acetate?
The InChIKey is GGZYBYILKSGZLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c14-11-3-1-10(2-4-11)9-13(15)17-12-5-7-16-8-6-12/h1-4,12H,5-9,14H2.
What are the key properties of oxan-4-yl 2-(4-aminophenyl)acetate?
oxan-4-yl 2-(4-aminophenyl)acetate has a molecular weight of 235.28 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-4-yl 2-(4-aminophenyl)acetate is sourced from PubChem (CID 61286946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).