C14H18N2O3S — CID 61287172
N-(2-carbamothioylphenyl)-2-(oxan-4-yloxy)acetamide (PubChem CID 61287172) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is N-(2-carbamothioylphenyl)-2-(oxan-4-yloxy)acetamide.
| Compound Name | N-(2-carbamothioylphenyl)-2-(oxan-4-yloxy)acetamide |
|---|---|
| PubChem CID | 61287172 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-(2-carbamothioylphenyl)-2-(oxan-4-yloxy)acetamide |
| SMILES | NC(=S)c1ccccc1NC(=O)COC1CCOCC1 |
| InChI | InChI=1S/C14H18N2O3S/c15-14(20)11-3-1-2-4-12(11)16-13(17)9-19-10-5-7-18-8-6-10/h1-4,10H,5-9H2,(H2,15,20)(H,16,17) |
| InChIKey | HNGINTHIPPQJNZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|